C14H27N3O3 — CID 96552056
tert-butyl (3S)-3-[[(2-aminoacetyl)-ethylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 96552056) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(2-aminoacetyl)-ethylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(2-aminoacetyl)-ethylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 96552056 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | tert-butyl (3S)-3-[[(2-aminoacetyl)-ethylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CCN(C[C@@H]1CCN(C(=O)OC(C)(C)C)C1)C(=O)CN |
| InChI | InChI=1S/C14H27N3O3/c1-5-16(12(18)8-15)9-11-6-7-17(10-11)13(19)20-14(2,3)4/h11H,5-10,15H2,1-4H3/t11-/m0/s1 |
| InChIKey | ANOXUUNEAADVOD-NSHDSACASA-N |
| XLogP | 1.05 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |