C21H36N2O2 — CID 156860747
tert-butyl 4-[(N,4-dimethylanilino)methyl]piperidine-1-carboxylate;ethane (PubChem CID 156860747) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is tert-butyl 4-[(N,4-dimethylanilino)methyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[(N,4-dimethylanilino)methyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 156860747 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | tert-butyl 4-[(N,4-dimethylanilino)methyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.Cc1ccc(N(C)CC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H30N2O2.C2H6/c1-15-6-8-17(9-7-15)20(5)14-16-10-12-21(13-11-16)18(22)23-19(2,3)4;1-2/h6-9,16H,10-14H2,1-5H3;1-2H3 |
| InChIKey | FNZNGAOTTLCPAG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|