C24H31ClN2O2 — CID 10024835
tert-butyl 4-[N-[(4-chlorophenyl)methyl]-4-methylanilino]piperidine-1-carboxylate (PubChem CID 10024835) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is tert-butyl 4-[N-[(4-chlorophenyl)methyl]-4-methylanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[N-[(4-chlorophenyl)methyl]-4-methylanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10024835 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | tert-butyl 4-[N-[(4-chlorophenyl)methyl]-4-methylanilino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(N(Cc2ccc(Cl)cc2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H31ClN2O2/c1-18-5-11-21(12-6-18)27(17-19-7-9-20(25)10-8-19)22-13-15-26(16-14-22)23(28)29-24(2,3)4/h5-12,22H,13-17H2,1-4H3 |
| InChIKey | TXYSUYOLHMKRHC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|