C18H27NO3 — CID 19796267
tert-butyl 4-[(4-methylphenyl)methoxy]piperidine-1-carboxylate (PubChem CID 19796267) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl 4-[(4-methylphenyl)methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-methylphenyl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19796267 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl 4-[(4-methylphenyl)methoxy]piperidine-1-carboxylate |
| SMILES | Cc1ccc(COC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-14-5-7-15(8-6-14)13-21-16-9-11-19(12-10-16)17(20)22-18(2,3)4/h5-8,16H,9-13H2,1-4H3 |
| InChIKey | NCXASBXSGHSDPA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |