C25H41NO5 — CID 134492988
tert-butyl 4-[4-(4-phenylmethoxybutoxy)butoxy]piperidine-1-carboxylate (PubChem CID 134492988) has the molecular formula C25H41NO5 and a molecular weight of 435.61 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-phenylmethoxybutoxy)butoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-phenylmethoxybutoxy)butoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134492988 |
| Molecular Formula | C25H41NO5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | tert-butyl 4-[4-(4-phenylmethoxybutoxy)butoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCCCCOCCCCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H41NO5/c1-25(2,3)31-24(27)26-15-13-23(14-16-26)30-20-10-9-18-28-17-7-8-19-29-21-22-11-5-4-6-12-22/h4-6,11-12,23H,7-10,13-21H2,1-3H3 |
| InChIKey | WUOCXQJUYMONES-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|