C21H33NO4 — CID 134481465
tert-butyl 3-hydroxy-3-(6-phenylmethoxyhexyl)azetidine-1-carboxylate (PubChem CID 134481465) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(6-phenylmethoxyhexyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(6-phenylmethoxyhexyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134481465 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(6-phenylmethoxyhexyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(CCCCCCOCc2ccccc2)C1 |
| InChI | InChI=1S/C21H33NO4/c1-20(2,3)26-19(23)22-16-21(24,17-22)13-9-4-5-10-14-25-15-18-11-7-6-8-12-18/h6-8,11-12,24H,4-5,9-10,13-17H2,1-3H3 |
| InChIKey | PREPDOKZIYIYNZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|