C35H52O4 — CID 177188889
tert-butyl 10-phenylmethoxy-3-(7-phenylmethoxyheptyl)dec-2-enoate (PubChem CID 177188889) has the molecular formula C35H52O4 and a molecular weight of 536.80 g/mol. Its IUPAC name is tert-butyl 10-phenylmethoxy-3-(7-phenylmethoxyheptyl)dec-2-enoate.
| Compound Name | tert-butyl 10-phenylmethoxy-3-(7-phenylmethoxyheptyl)dec-2-enoate |
|---|---|
| PubChem CID | 177188889 |
| Molecular Formula | C35H52O4 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | tert-butyl 10-phenylmethoxy-3-(7-phenylmethoxyheptyl)dec-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=C(CCCCCCCOCc1ccccc1)CCCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C35H52O4/c1-35(2,3)39-34(36)28-31(20-12-6-4-8-18-26-37-29-32-22-14-10-15-23-32)21-13-7-5-9-19-27-38-30-33-24-16-11-17-25-33/h10-11,14-17,22-25,28H,4-9,12-13,18-21,26-27,29-30H2,1-3H3 |
| InChIKey | NOWMWKHCWQGVLE-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|