C17H27NO5 — CID 102329033
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-6-phenylmethoxyhexanamide (PubChem CID 102329033) has the molecular formula C17H27NO5 and a molecular weight of 325.40 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-6-phenylmethoxyhexanamide.
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-6-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 102329033 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-6-phenylmethoxyhexanamide |
| SMILES | O=C(CCCCCOCc1ccccc1)NC(CO)(CO)CO |
| InChI | InChI=1S/C17H27NO5/c19-12-17(13-20,14-21)18-16(22)9-5-2-6-10-23-11-15-7-3-1-4-8-15/h1,3-4,7-8,19-21H,2,5-6,9-14H2,(H,18,22) |
| InChIKey | BXRSARJXZDGLKR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|