C34H40N4O4 — CID 11678584
6-phenylmethoxy-N-[7-(6-phenylmethoxyhexanoylamino)-1,8-naphthyridin-2-yl]hexanamide (PubChem CID 11678584) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 6-phenylmethoxy-N-[7-(6-phenylmethoxyhexanoylamino)-1,8-naphthyridin-2-yl]hexanamide.
| Compound Name | 6-phenylmethoxy-N-[7-(6-phenylmethoxyhexanoylamino)-1,8-naphthyridin-2-yl]hexanamide |
|---|---|
| PubChem CID | 11678584 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 6-phenylmethoxy-N-[7-(6-phenylmethoxyhexanoylamino)-1,8-naphthyridin-2-yl]hexanamide |
| SMILES | O=C(CCCCCOCc1ccccc1)Nc1ccc2ccc(NC(=O)CCCCCOCc3ccccc3)nc2n1 |
| InChI | InChI=1S/C34H40N4O4/c39-32(17-9-3-11-23-41-25-27-13-5-1-6-14-27)35-30-21-19-29-20-22-31(38-34(29)37-30)36-33(40)18-10-4-12-24-42-26-28-15-7-2-8-16-28/h1-2,5-8,13-16,19-22H,3-4,9-12,17-18,23-26H2,(H2,35,36,37,38,39,40) |
| InChIKey | HVWLXXBATGNCKM-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|