C21H31F2NO3 — CID 154612846
tert-butyl 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate (PubChem CID 154612846) has the molecular formula C21H31F2NO3 and a molecular weight of 383.48 g/mol. Its IUPAC name is tert-butyl 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154612846 |
| Molecular Formula | C21H31F2NO3 |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(F)(F)CCCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31F2NO3/c1-20(2,3)27-19(25)24-13-10-18(11-14-24)21(22,23)12-7-15-26-16-17-8-5-4-6-9-17/h4-6,8-9,18H,7,10-16H2,1-3H3 |
| InChIKey | VGEHZSHDNGETRG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|