C21H31NO3 — CID 58128527
tert-butyl 4-[2-(phenylmethoxymethyl)cyclopropyl]piperidine-1-carboxylate (PubChem CID 58128527) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl 4-[2-(phenylmethoxymethyl)cyclopropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(phenylmethoxymethyl)cyclopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58128527 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl 4-[2-(phenylmethoxymethyl)cyclopropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CC2COCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31NO3/c1-21(2,3)25-20(23)22-11-9-17(10-12-22)19-13-18(19)15-24-14-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3 |
| InChIKey | UCYSYHOTMPDDNG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |