C17H22F2NO3- — CID 154017640
4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate (PubChem CID 154017640) has the molecular formula C17H22F2NO3- and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate.
| Compound Name | 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154017640 |
| Molecular Formula | C17H22F2NO3- |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-(1,1-difluoro-4-phenylmethoxybutyl)piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(C(F)(F)CCCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H23F2NO3/c18-17(19,15-7-10-20(11-8-15)16(21)22)9-4-12-23-13-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,21,22)/p-1 |
| InChIKey | AYFLFSGPFWVOOG-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|