C30H32NO8- — CID 22127304
3-[(4-carboxyphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate (PubChem CID 22127304) has the molecular formula C30H32NO8- and a molecular weight of 534.59 g/mol. Its IUPAC name is 3-[(4-carboxyphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | 3-[(4-carboxyphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22127304 |
| Molecular Formula | C30H32NO8- |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 3-[(4-carboxyphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
| SMILES | O=C(O)c1ccc(COC2CN(C(=O)[O-])CC(O)C2c2ccc(OCCCOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H33NO8/c32-26-17-31(30(35)36)18-27(39-20-22-7-9-24(10-8-22)29(33)34)28(26)23-11-13-25(14-12-23)38-16-4-15-37-19-21-5-2-1-3-6-21/h1-3,5-14,26-28,32H,4,15-20H2,(H,33,34)(H,35,36)/p-1 |
| InChIKey | OQWIOACWIVONOE-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|