C32H38NO6- — CID 22126688
3-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-[(4-propan-2-ylphenyl)methoxy]piperidine-1-carboxylate (PubChem CID 22126688) has the molecular formula C32H38NO6- and a molecular weight of 532.66 g/mol. Its IUPAC name is 3-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-[(4-propan-2-ylphenyl)methoxy]piperidine-1-carboxylate.
| Compound Name | 3-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-[(4-propan-2-ylphenyl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22126688 |
| Molecular Formula | C32H38NO6- |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 3-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-[(4-propan-2-ylphenyl)methoxy]piperidine-1-carboxylate |
| SMILES | CC(C)c1ccc(COC2CN(C(=O)[O-])CC(O)C2c2ccc(OCCCOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H39NO6/c1-23(2)26-11-9-25(10-12-26)22-39-30-20-33(32(35)36)19-29(34)31(30)27-13-15-28(16-14-27)38-18-6-17-37-21-24-7-4-3-5-8-24/h3-5,7-16,23,29-31,34H,6,17-22H2,1-2H3,(H,35,36)/p-1 |
| InChIKey | ANUBHZRBYRFXJE-UHFFFAOYSA-M |
| XLogP | 4.48 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|