C33H34NO6- — CID 22128644
3-[(8-hydroxynaphthalen-2-yl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate (PubChem CID 22128644) has the molecular formula C33H34NO6- and a molecular weight of 540.64 g/mol. Its IUPAC name is 3-[(8-hydroxynaphthalen-2-yl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | 3-[(8-hydroxynaphthalen-2-yl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128644 |
| Molecular Formula | C33H34NO6- |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[(8-hydroxynaphthalen-2-yl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc3cccc(O)c3c2)C1 |
| InChI | InChI=1S/C33H35NO6/c35-31-9-4-8-26-11-10-25(20-30(26)31)23-40-32-21-34(33(36)37)17-16-29(32)27-12-14-28(15-13-27)39-19-5-18-38-22-24-6-2-1-3-7-24/h1-4,6-15,20,29,32,35H,5,16-19,21-23H2,(H,36,37)/p-1 |
| InChIKey | QGXHNAALXGCRCV-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|