C31H30NO4S- — CID 22128353
3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylsulfanylethoxy)phenyl]piperidine-1-carboxylate (PubChem CID 22128353) has the molecular formula C31H30NO4S- and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylsulfanylethoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylsulfanylethoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128353 |
| Molecular Formula | C31H30NO4S- |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylsulfanylethoxy)phenyl]piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(c2ccc(OCCSc3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C31H31NO4S/c33-31(34)32-17-16-29(30(21-32)36-22-23-10-11-24-6-4-5-7-26(24)20-23)25-12-14-27(15-13-25)35-18-19-37-28-8-2-1-3-9-28/h1-15,20,29-30H,16-19,21-22H2,(H,33,34)/p-1 |
| InChIKey | BOPLTGQXUHIQHA-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|