C31H30BrNO5 — CID 22128667
4-[4-[2-(4-bromophenoxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylic acid (PubChem CID 22128667) has the molecular formula C31H30BrNO5 and a molecular weight of 576.49 g/mol. Its IUPAC name is 4-[4-[2-(4-bromophenoxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[2-(4-bromophenoxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128667 |
| Molecular Formula | C31H30BrNO5 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | 4-[4-[2-(4-bromophenoxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(OCCOc3ccc(Br)cc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C31H30BrNO5/c32-26-9-13-28(14-10-26)37-18-17-36-27-11-7-24(8-12-27)29-15-16-33(31(34)35)20-30(29)38-21-22-5-6-23-3-1-2-4-25(23)19-22/h1-14,19,29-30H,15-18,20-21H2,(H,34,35) |
| InChIKey | OYFWJYWYOAUZBV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|