C37H41NO5 — CID 86604489
tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylate (PubChem CID 86604489) has the molecular formula C37H41NO5 and a molecular weight of 579.74 g/mol. Its IUPAC name is tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86604489 |
| Molecular Formula | C37H41NO5 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(OC/C=C/COc3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C37H41NO5/c1-37(2,3)43-36(39)38-22-21-34(35(26-38)42-27-28-15-16-29-11-7-8-12-31(29)25-28)30-17-19-33(20-18-30)41-24-10-9-23-40-32-13-5-4-6-14-32/h4-20,25,34-35H,21-24,26-27H2,1-3H3/b10-9+ |
| InChIKey | QOOALTXBDITSLJ-MDZDMXLPSA-N |
| XLogP | 8.16 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|