C44H46ClNO6 — CID 159062385
benzoyl chloride;tert-butyl 4-[4-(3-benzoyloxypropyl)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 159062385) has the molecular formula C44H46ClNO6 and a molecular weight of 720.31 g/mol. Its IUPAC name is benzoyl chloride;tert-butyl 4-[4-(3-benzoyloxypropyl)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | benzoyl chloride;tert-butyl 4-[4-(3-benzoyloxypropyl)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159062385 |
| Molecular Formula | C44H46ClNO6 |
| Molecular Weight | 720.31 g/mol |
| Exact Mass | 719.30 |
| IUPAC Name | benzoyl chloride;tert-butyl 4-[4-(3-benzoyloxypropyl)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(CCCOC(=O)c3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1.O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C37H41NO5.C7H5ClO/c1-37(2,3)43-36(40)38-22-21-33(34(25-38)42-26-28-17-18-29-11-7-8-14-32(29)24-28)30-19-15-27(16-20-30)10-9-23-41-35(39)31-12-5-4-6-13-31;8-7(9)6-4-2-1-3-5-6/h4-8,11-20,24,33-34H,9-10,21-23,25-26H2,1-3H3;1-5H |
| InChIKey | JYQAUVSONBIXSR-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.31 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|