C30H32FNO4 — CID 86604453
tert-butyl 3-[(3-benzoylphenyl)methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 86604453) has the molecular formula C30H32FNO4 and a molecular weight of 489.59 g/mol. Its IUPAC name is tert-butyl 3-[(3-benzoylphenyl)methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-benzoylphenyl)methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86604453 |
| Molecular Formula | C30H32FNO4 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | tert-butyl 3-[(3-benzoylphenyl)methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(F)cc2)C(OCc2cccc(C(=O)c3ccccc3)c2)C1 |
| InChI | InChI=1S/C30H32FNO4/c1-30(2,3)36-29(34)32-17-16-26(22-12-14-25(31)15-13-22)27(19-32)35-20-21-8-7-11-24(18-21)28(33)23-9-5-4-6-10-23/h4-15,18,26-27H,16-17,19-20H2,1-3H3 |
| InChIKey | SURUEBSBPPAMTD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |