C38H45NO5 — CID 54446458
tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-(4-phenylmethoxybutoxy)phenyl]piperidine-1-carboxylate (PubChem CID 54446458) has the molecular formula C38H45NO5 and a molecular weight of 595.78 g/mol. Its IUPAC name is tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-(4-phenylmethoxybutoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-(4-phenylmethoxybutoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54446458 |
| Molecular Formula | C38H45NO5 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | tert-butyl 3-(naphthalen-2-ylmethoxy)-4-[4-(4-phenylmethoxybutoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(OCCCCOCc3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C38H45NO5/c1-38(2,3)44-37(40)39-22-21-35(36(26-39)43-28-30-15-16-31-13-7-8-14-33(31)25-30)32-17-19-34(20-18-32)42-24-10-9-23-41-27-29-11-5-4-6-12-29/h4-8,11-20,25,35-36H,9-10,21-24,26-28H2,1-3H3 |
| InChIKey | WRVYXXXXMMXRMD-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|