C36H42N2O5 — CID 22128195
3-[[7-[(dimethylamino)methyl]naphthalen-2-yl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 22128195) has the molecular formula C36H42N2O5 and a molecular weight of 582.74 g/mol. Its IUPAC name is 3-[[7-[(dimethylamino)methyl]naphthalen-2-yl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[[7-[(dimethylamino)methyl]naphthalen-2-yl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128195 |
| Molecular Formula | C36H42N2O5 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 3-[[7-[(dimethylamino)methyl]naphthalen-2-yl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | CN(C)Cc1ccc2ccc(COC3CN(C(=O)O)CCC3c3ccc(OCCCOCc4ccccc4)cc3)cc2c1 |
| InChI | InChI=1S/C36H42N2O5/c1-37(2)23-28-9-11-30-12-10-29(22-32(30)21-28)26-43-35-24-38(36(39)40)18-17-34(35)31-13-15-33(16-14-31)42-20-6-19-41-25-27-7-4-3-5-8-27/h3-5,7-16,21-22,34-35H,6,17-20,23-26H2,1-2H3,(H,39,40) |
| InChIKey | KYMRVXQTHDHFEG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|