C34H36N2O5 — CID 87931344
3-[(Z)-N-hydroxy-C-(naphthalen-2-ylmethyl)carbonimidoyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 87931344) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 3-[(Z)-N-hydroxy-C-(naphthalen-2-ylmethyl)carbonimidoyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(Z)-N-hydroxy-C-(naphthalen-2-ylmethyl)carbonimidoyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87931344 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 3-[(Z)-N-hydroxy-C-(naphthalen-2-ylmethyl)carbonimidoyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(OCCCOCc3ccccc3)cc2)C(/C(Cc2ccc3ccccc3c2)=N\O)C1 |
| InChI | InChI=1S/C34H36N2O5/c37-34(38)36-18-17-31(32(23-36)33(35-39)22-26-11-12-27-9-4-5-10-29(27)21-26)28-13-15-30(16-14-28)41-20-6-19-40-24-25-7-2-1-3-8-25/h1-5,7-16,21,31-32,39H,6,17-20,22-24H2,(H,37,38)/b35-33- |
| InChIKey | BUJSWSLAWQQVMS-OAPYJULQSA-N |
| XLogP | 6.98 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|