C32H32NO5- — CID 22128190
3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylate (PubChem CID 22128190) has the molecular formula C32H32NO5- and a molecular weight of 510.61 g/mol. Its IUPAC name is 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128190 |
| Molecular Formula | C32H32NO5- |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(c2ccc(OCCOCc3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C32H33NO5/c34-32(35)33-17-16-30(31(21-33)38-23-25-10-11-26-8-4-5-9-28(26)20-25)27-12-14-29(15-13-27)37-19-18-36-22-24-6-2-1-3-7-24/h1-15,20,30-31H,16-19,21-23H2,(H,34,35)/p-1 |
| InChIKey | JKLHISUMBVQTRX-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|