C34H34NO7- — CID 22128032
4-[4-[2-(2-methoxy-2-phenylacetyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 22128032) has the molecular formula C34H34NO7- and a molecular weight of 568.65 g/mol. Its IUPAC name is 4-[4-[2-(2-methoxy-2-phenylacetyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | 4-[4-[2-(2-methoxy-2-phenylacetyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128032 |
| Molecular Formula | C34H34NO7- |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 4-[4-[2-(2-methoxy-2-phenylacetyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | COC(C(=O)OCCOc1ccc(C2CCN(C(=O)[O-])CC2OCc2ccc3ccccc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H35NO7/c1-39-32(27-8-3-2-4-9-27)33(36)41-20-19-40-29-15-13-26(14-16-29)30-17-18-35(34(37)38)22-31(30)42-23-24-11-12-25-7-5-6-10-28(25)21-24/h2-16,21,30-32H,17-20,22-23H2,1H3,(H,37,38)/p-1 |
| InChIKey | RRBZIXCLHTZEOG-UHFFFAOYSA-M |
| XLogP | 4.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|