C39H48NO7Si- — CID 22128128
4-[4-(3-phenylmethoxypropoxy)phenyl]-3-[[6-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate (PubChem CID 22128128) has the molecular formula C39H48NO7Si- and a molecular weight of 670.90 g/mol. Its IUPAC name is 4-[4-(3-phenylmethoxypropoxy)phenyl]-3-[[6-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | 4-[4-(3-phenylmethoxypropoxy)phenyl]-3-[[6-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128128 |
| Molecular Formula | C39H48NO7Si- |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 4-[4-(3-phenylmethoxypropoxy)phenyl]-3-[[6-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCOc1ccc2cc(COC3CN(C(=O)[O-])CCC3c3ccc(OCCCOCc4ccccc4)cc3)ccc2c1 |
| InChI | InChI=1S/C39H49NO7Si/c1-48(2,3)23-22-44-29-47-36-17-14-33-24-31(10-11-34(33)25-36)28-46-38-26-40(39(41)42)19-18-37(38)32-12-15-35(16-13-32)45-21-7-20-43-27-30-8-5-4-6-9-30/h4-6,8-17,24-25,37-38H,7,18-23,26-29H2,1-3H3,(H,41,42)/p-1 |
| InChIKey | AMSQCSRMNHTMAI-UHFFFAOYSA-M |
| XLogP | 7.23 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|