C37H47NO7SSi — CID 22128839
4-[4-[3-(thiophen-2-ylmethoxy)propoxy]phenyl]-3-[[7-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylic acid (PubChem CID 22128839) has the molecular formula C37H47NO7SSi and a molecular weight of 677.94 g/mol. Its IUPAC name is 4-[4-[3-(thiophen-2-ylmethoxy)propoxy]phenyl]-3-[[7-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[3-(thiophen-2-ylmethoxy)propoxy]phenyl]-3-[[7-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128839 |
| Molecular Formula | C37H47NO7SSi |
| Molecular Weight | 677.94 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 4-[4-[3-(thiophen-2-ylmethoxy)propoxy]phenyl]-3-[[7-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCOc1ccc2ccc(COC3CN(C(=O)O)CCC3c3ccc(OCCCOCc4cccs4)cc3)cc2c1 |
| InChI | InChI=1S/C37H47NO7SSi/c1-47(2,3)21-19-42-27-45-33-14-9-29-8-7-28(22-31(29)23-33)25-44-36-24-38(37(39)40)16-15-35(36)30-10-12-32(13-11-30)43-18-5-17-41-26-34-6-4-20-46-34/h4,6-14,20,22-23,35-36H,5,15-19,21,24-27H2,1-3H3,(H,39,40) |
| InChIKey | QMDANZJGOJOQLQ-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.94 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|