C39H51NO6Si — CID 70126616
2-[[7-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]naphthalen-2-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 70126616) has the molecular formula C39H51NO6Si and a molecular weight of 657.92 g/mol. Its IUPAC name is 2-[[7-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]naphthalen-2-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]naphthalen-2-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 70126616 |
| Molecular Formula | C39H51NO6Si |
| Molecular Weight | 657.92 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | 2-[[7-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]naphthalen-2-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCNCC2OCc2ccc3ccc(OCOCC[Si](C)(C)C)cc3c2)cc1 |
| InChI | InChI=1S/C39H51NO6Si/c1-41-38-9-6-5-8-33(38)28-42-20-7-21-44-35-15-13-32(14-16-35)37-18-19-40-26-39(37)45-27-30-10-11-31-12-17-36(25-34(31)24-30)46-29-43-22-23-47(2,3)4/h5-6,8-17,24-25,37,39-40H,7,18-23,26-29H2,1-4H3 |
| InChIKey | JPPFYVIFCAFUCT-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.92 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|