C36H47NO7 — CID 145126257
methoxymethanol;(3R,4R)-3-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine;molecular hydrogen (PubChem CID 145126257) has the molecular formula C36H47NO7 and a molecular weight of 605.77 g/mol. Its IUPAC name is methoxymethanol;(3R,4R)-3-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine;molecular hydrogen.
| Compound Name | methoxymethanol;(3R,4R)-3-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine;molecular hydrogen |
|---|---|
| PubChem CID | 145126257 |
| Molecular Formula | C36H47NO7 |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | methoxymethanol;(3R,4R)-3-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine;molecular hydrogen |
| SMILES | COCO.COc1ccccc1COCCCOc1ccc([C@H]2CCNC[C@@H]2OCc2cc(OC)c3ccccc3c2)cc1.[H][H] |
| InChI | InChI=1S/C34H39NO5.C2H6O2.H2/c1-36-32-11-6-4-9-28(32)24-38-18-7-19-39-29-14-12-26(13-15-29)31-16-17-35-22-34(31)40-23-25-20-27-8-3-5-10-30(27)33(21-25)37-2;1-4-2-3;/h3-6,8-15,20-21,31,34-35H,7,16-19,22-24H2,1-2H3;3H,2H2,1H3;1H/t31-,34+;;/m1../s1 |
| InChIKey | SZYKKJHDWMVZNA-OTODMFDSSA-N |
| XLogP | 6.33 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|