C36H43NO7 — CID 134372243
(3S,4R)-3-(methoxymethoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine (PubChem CID 134372243) has the molecular formula C36H43NO7 and a molecular weight of 601.74 g/mol. Its IUPAC name is (3S,4R)-3-(methoxymethoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine.
| Compound Name | (3S,4R)-3-(methoxymethoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine |
|---|---|
| PubChem CID | 134372243 |
| Molecular Formula | C36H43NO7 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | (3S,4R)-3-(methoxymethoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine |
| SMILES | COCO[C@@H]1CNCC(OCc2cc(OC)c3ccccc3c2)[C@H]1c1ccc(OCCCOCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C36H43NO7/c1-38-25-44-35-22-37-21-34(43-23-26-19-28-9-4-6-11-31(28)33(20-26)40-3)36(35)27-13-15-30(16-14-27)42-18-8-17-41-24-29-10-5-7-12-32(29)39-2/h4-7,9-16,19-20,34-37H,8,17-18,21-25H2,1-3H3/t34?,35-,36-/m1/s1 |
| InChIKey | PXXXJPXDEIYISB-CPHKJRAMSA-N |
| XLogP | 6.10 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|