C41H52N2O11 — CID 70298435
5-(dihydroxyamino)oxypentyl [5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl carbonate (PubChem CID 70298435) has the molecular formula C41H52N2O11 and a molecular weight of 748.87 g/mol. Its IUPAC name is 5-(dihydroxyamino)oxypentyl [5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl carbonate.
| Compound Name | 5-(dihydroxyamino)oxypentyl [5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl carbonate |
|---|---|
| PubChem CID | 70298435 |
| Molecular Formula | C41H52N2O11 |
| Molecular Weight | 748.87 g/mol |
| Exact Mass | 748.36 |
| IUPAC Name | 5-(dihydroxyamino)oxypentyl [5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl carbonate |
| SMILES | COc1ccccc1COCCCOc1ccc(C2C(COC(=O)OCCCCCON(O)O)CNCC2OCc2cc(OC)c3ccccc3c2)cc1 |
| InChI | InChI=1S/C41H52N2O11/c1-47-37-14-7-5-12-33(37)28-49-19-10-21-50-35-17-15-31(16-18-35)40-34(29-53-41(44)51-20-8-3-9-22-54-43(45)46)25-42-26-39(40)52-27-30-23-32-11-4-6-13-36(32)38(24-30)48-2/h4-7,11-18,23-24,34,39-40,42,45-46H,3,8-10,19-22,25-29H2,1-2H3 |
| InChIKey | IPRJOEXPBBSKGU-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.87 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|