C43H54N2O14 — CID 25174783
[1-methoxy-3-[5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxypropan-2-yl] 2-(2-nitrooxyethoxy)ethyl carbonate (PubChem CID 25174783) has the molecular formula C43H54N2O14 and a molecular weight of 822.90 g/mol. Its IUPAC name is [1-methoxy-3-[5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxypropan-2-yl] 2-(2-nitrooxyethoxy)ethyl carbonate.
| Compound Name | [1-methoxy-3-[5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxypropan-2-yl] 2-(2-nitrooxyethoxy)ethyl carbonate |
|---|---|
| PubChem CID | 25174783 |
| Molecular Formula | C43H54N2O14 |
| Molecular Weight | 822.90 g/mol |
| Exact Mass | 822.36 |
| IUPAC Name | [1-methoxy-3-[5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxypropan-2-yl] 2-(2-nitrooxyethoxy)ethyl carbonate |
| SMILES | COCC(COC1CNCC(OCc2cc(OC)c3ccccc3c2)C1c1ccc(OCCCOCc2ccccc2OC)cc1)OC(=O)OCCOCCO[N+](=O)[O-] |
| InChI | InChI=1S/C43H54N2O14/c1-49-29-36(59-43(46)55-21-19-52-20-22-58-45(47)48)30-57-41-26-44-25-40(56-27-31-23-33-9-4-6-11-37(33)39(24-31)51-3)42(41)32-13-15-35(16-14-32)54-18-8-17-53-28-34-10-5-7-12-38(34)50-2/h4-7,9-16,23-24,36,40-42,44H,8,17-22,25-30H2,1-3H3 |
| InChIKey | DECPXIPBRKFIDO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 173.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.90 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|