C42H52N2O12 — CID 25175114
[4-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]-4-oxobutyl] nitrate (PubChem CID 25175114) has the molecular formula C42H52N2O12 and a molecular weight of 776.88 g/mol. Its IUPAC name is [4-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]-4-oxobutyl] nitrate.
| Compound Name | [4-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 25175114 |
| Molecular Formula | C42H52N2O12 |
| Molecular Weight | 776.88 g/mol |
| Exact Mass | 776.35 |
| IUPAC Name | [4-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]-4-oxobutyl] nitrate |
| SMILES | COCC(O)COC1CN(C(=O)CCCO[N+](=O)[O-])CC(OCc2cc(OC)c3ccccc3c2)C1c1ccc(OCCCOCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C42H52N2O12/c1-49-28-34(45)29-55-40-25-43(41(46)14-8-21-56-44(47)48)24-39(54-26-30-22-32-10-4-6-12-36(32)38(23-30)51-3)42(40)31-15-17-35(18-16-31)53-20-9-19-52-27-33-11-5-7-13-37(33)50-2/h4-7,10-13,15-18,22-23,34,39-40,42,45H,8-9,14,19-21,24-29H2,1-3H3 |
| InChIKey | UZVRYWTTXPJWKR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.88 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|