C46H52N2O12 — CID 25175281
[3-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carbonyl]phenyl]methyl nitrate (PubChem CID 25175281) has the molecular formula C46H52N2O12 and a molecular weight of 824.92 g/mol. Its IUPAC name is [3-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carbonyl]phenyl]methyl nitrate.
| Compound Name | [3-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carbonyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 25175281 |
| Molecular Formula | C46H52N2O12 |
| Molecular Weight | 824.92 g/mol |
| Exact Mass | 824.35 |
| IUPAC Name | [3-[3-(2-hydroxy-3-methoxypropoxy)-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carbonyl]phenyl]methyl nitrate |
| SMILES | COCC(O)COC1CN(C(=O)c2cccc(CO[N+](=O)[O-])c2)CC(OCc2cc(OC)c3ccccc3c2)C1c1ccc(OCCCOCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C46H52N2O12/c1-53-30-38(49)31-59-44-26-47(46(50)36-13-8-10-32(22-36)28-60-48(51)52)25-43(58-27-33-23-35-11-4-6-14-40(35)42(24-33)55-3)45(44)34-16-18-39(19-17-34)57-21-9-20-56-29-37-12-5-7-15-41(37)54-2/h4-8,10-19,22-24,38,43-45,49H,9,20-21,25-31H2,1-3H3 |
| InChIKey | UWKGGXDRZTYFOL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.92 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|