C40H50N2O10 — CID 70303591
6-(dihydroxyamino)oxy-1-[3-hydroxy-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]hexan-1-one (PubChem CID 70303591) has the molecular formula C40H50N2O10 and a molecular weight of 718.84 g/mol. Its IUPAC name is 6-(dihydroxyamino)oxy-1-[3-hydroxy-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]hexan-1-one.
| Compound Name | 6-(dihydroxyamino)oxy-1-[3-hydroxy-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 70303591 |
| Molecular Formula | C40H50N2O10 |
| Molecular Weight | 718.84 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | 6-(dihydroxyamino)oxy-1-[3-hydroxy-5-[(4-methoxynaphthalen-2-yl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-1-yl]hexan-1-one |
| SMILES | COc1ccccc1COCCCOc1ccc(C2C(O)CN(C(=O)CCCCCON(O)O)CC2OCc2cc(OC)c3ccccc3c2)cc1 |
| InChI | InChI=1S/C40H50N2O10/c1-47-36-14-8-6-12-32(36)28-49-20-10-21-50-33-18-16-30(17-19-33)40-35(43)25-41(39(44)15-4-3-9-22-52-42(45)46)26-38(40)51-27-29-23-31-11-5-7-13-34(31)37(24-29)48-2/h5-8,11-14,16-19,23-24,35,38,40,43,45-46H,3-4,9-10,15,20-22,25-28H2,1-2H3 |
| InChIKey | AYKRYULVQASNHZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.84 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|