C38H46FNO8 — CID 70072171
1-[(3S,4R,5R)-4-[4-[3-[(4-fluoro-2-methoxyphenyl)methoxy]propoxy]phenyl]-5-[(4-methoxynaphthalen-2-yl)methoxy]piperidin-3-yl]oxy-1-methoxypropan-2-ol (PubChem CID 70072171) has the molecular formula C38H46FNO8 and a molecular weight of 663.78 g/mol. Its IUPAC name is 1-[(3S,4R,5R)-4-[4-[3-[(4-fluoro-2-methoxyphenyl)methoxy]propoxy]phenyl]-5-[(4-methoxynaphthalen-2-yl)methoxy]piperidin-3-yl]oxy-1-methoxypropan-2-ol.
| Compound Name | 1-[(3S,4R,5R)-4-[4-[3-[(4-fluoro-2-methoxyphenyl)methoxy]propoxy]phenyl]-5-[(4-methoxynaphthalen-2-yl)methoxy]piperidin-3-yl]oxy-1-methoxypropan-2-ol |
|---|---|
| PubChem CID | 70072171 |
| Molecular Formula | C38H46FNO8 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.32 |
| IUPAC Name | 1-[(3S,4R,5R)-4-[4-[3-[(4-fluoro-2-methoxyphenyl)methoxy]propoxy]phenyl]-5-[(4-methoxynaphthalen-2-yl)methoxy]piperidin-3-yl]oxy-1-methoxypropan-2-ol |
| SMILES | COc1cc(F)ccc1COCCCOc1ccc([C@@H]2[C@@H](OCc3cc(OC)c4ccccc4c3)CNC[C@H]2OC(OC)C(C)O)cc1 |
| InChI | InChI=1S/C38H46FNO8/c1-25(41)38(44-4)48-36-22-40-21-35(47-23-26-18-28-8-5-6-9-32(28)34(19-26)43-3)37(36)27-11-14-31(15-12-27)46-17-7-16-45-24-29-10-13-30(39)20-33(29)42-2/h5-6,8-15,18-20,25,35-38,40-41H,7,16-17,21-24H2,1-4H3/t25?,35-,36+,37+,38?/m0/s1 |
| InChIKey | HQWCATCWQYSPKP-WPGFLVSMSA-N |
| XLogP | 5.99 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|