C32H35NO3 — CID 100967467
(3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine (PubChem CID 100967467) has the molecular formula C32H35NO3 and a molecular weight of 481.64 g/mol. Its IUPAC name is (3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine.
| Compound Name | (3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 100967467 |
| Molecular Formula | C32H35NO3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine |
| SMILES | c1ccc(COCCCOc2ccc([C@@H]3CCNC[C@H]3OCc3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C32H35NO3/c1-2-7-25(8-3-1)23-34-19-6-20-35-30-15-13-28(14-16-30)31-17-18-33-22-32(31)36-24-26-11-12-27-9-4-5-10-29(27)21-26/h1-5,7-16,21,31-33H,6,17-20,22-24H2/t31-,32+/m0/s1 |
| InChIKey | SBQHXMHGXWOGFR-AJQTZOPKSA-N |
| XLogP | 6.49 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|