C31H33NO3 — CID 100967460
(3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine (PubChem CID 100967460) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is (3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine.
| Compound Name | (3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 100967460 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (3S,4S)-3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine |
| SMILES | c1ccc(OCCOCc2ccc([C@@H]3CCNC[C@H]3OCc3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C31H33NO3/c1-2-8-29(9-3-1)34-19-18-33-22-24-10-14-27(15-11-24)30-16-17-32-21-31(30)35-23-25-12-13-26-6-4-5-7-28(26)20-25/h1-15,20,30-32H,16-19,21-23H2/t30-,31+/m0/s1 |
| InChIKey | CVQOAVLAQRKSIT-IOWSJCHKSA-N |
| XLogP | 6.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|