C34H48FNO5Si2 — CID 90838286
2-trimethylsilylethyl 4-(4-fluorophenyl)-3-[[5-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate (PubChem CID 90838286) has the molecular formula C34H48FNO5Si2 and a molecular weight of 625.93 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-(4-fluorophenyl)-3-[[5-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 4-(4-fluorophenyl)-3-[[5-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90838286 |
| Molecular Formula | C34H48FNO5Si2 |
| Molecular Weight | 625.93 g/mol |
| Exact Mass | 625.31 |
| IUPAC Name | 2-trimethylsilylethyl 4-(4-fluorophenyl)-3-[[5-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCOc1cccc2cc(COC3CN(C(=O)OCC[Si](C)(C)C)CCC3c3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C34H48FNO5Si2/c1-42(2,3)20-18-38-25-41-32-9-7-8-28-22-26(10-15-30(28)32)24-40-33-23-36(34(37)39-19-21-43(4,5)6)17-16-31(33)27-11-13-29(35)14-12-27/h7-15,22,31,33H,16-21,23-25H2,1-6H3 |
| InChIKey | UQEQQKBVDXFUMV-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.93 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|