C36H43N2O5SSi- — CID 22128357
4-[4-(2-pyridin-2-ylsulfanylethyl)phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate (PubChem CID 22128357) has the molecular formula C36H43N2O5SSi- and a molecular weight of 643.90 g/mol. Its IUPAC name is 4-[4-(2-pyridin-2-ylsulfanylethyl)phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | 4-[4-(2-pyridin-2-ylsulfanylethyl)phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128357 |
| Molecular Formula | C36H43N2O5SSi- |
| Molecular Weight | 643.90 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | 4-[4-(2-pyridin-2-ylsulfanylethyl)phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCOc1cc(COC2CN(C(=O)[O-])CCC2c2ccc(CCSc3ccccn3)cc2)cc2ccccc12 |
| InChI | InChI=1S/C36H44N2O5SSi/c1-45(2,3)21-19-41-26-43-33-23-28(22-30-8-4-5-9-31(30)33)25-42-34-24-38(36(39)40)18-15-32(34)29-13-11-27(12-14-29)16-20-44-35-10-6-7-17-37-35/h4-14,17,22-23,32,34H,15-16,18-21,24-26H2,1-3H3,(H,39,40)/p-1 |
| InChIKey | OVHOWBYGUZHUFO-UHFFFAOYSA-M |
| XLogP | 6.98 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.90 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|