C37H45N2O7Si- — CID 22128786
4-[4-[2-(pyridin-3-ylmethoxy)ethoxy]phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate (PubChem CID 22128786) has the molecular formula C37H45N2O7Si- and a molecular weight of 657.86 g/mol. Its IUPAC name is 4-[4-[2-(pyridin-3-ylmethoxy)ethoxy]phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | 4-[4-[2-(pyridin-3-ylmethoxy)ethoxy]phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128786 |
| Molecular Formula | C37H45N2O7Si- |
| Molecular Weight | 657.86 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | 4-[4-[2-(pyridin-3-ylmethoxy)ethoxy]phenyl]-3-[[4-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCOc1cc(COC2CN(C(=O)[O-])CCC2c2ccc(OCCOCc3cccnc3)cc2)cc2ccccc12 |
| InChI | InChI=1S/C37H46N2O7Si/c1-47(2,3)20-19-43-27-46-35-22-29(21-31-8-4-5-9-33(31)35)26-45-36-24-39(37(40)41)16-14-34(36)30-10-12-32(13-11-30)44-18-17-42-25-28-7-6-15-38-23-28/h4-13,15,21-23,34,36H,14,16-20,24-27H2,1-3H3,(H,40,41)/p-1 |
| InChIKey | XBPMWDLRFXGRHV-UHFFFAOYSA-M |
| XLogP | 6.24 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|