C35H42FNO3Si — CID 22127049
2-[[3-[[1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]oxymethyl]naphthalen-1-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 22127049) has the molecular formula C35H42FNO3Si and a molecular weight of 571.81 g/mol. Its IUPAC name is 2-[[3-[[1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]oxymethyl]naphthalen-1-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[[1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]oxymethyl]naphthalen-1-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22127049 |
| Molecular Formula | C35H42FNO3Si |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 2-[[3-[[1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]oxymethyl]naphthalen-1-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCOc1cc(COC2CN(Cc3ccccc3)CCC2c2ccc(F)cc2)cc2ccccc12 |
| InChI | InChI=1S/C35H42FNO3Si/c1-41(2,3)20-19-38-26-40-34-22-28(21-30-11-7-8-12-32(30)34)25-39-35-24-37(23-27-9-5-4-6-10-27)18-17-33(35)29-13-15-31(36)16-14-29/h4-16,21-22,33,35H,17-20,23-26H2,1-3H3 |
| InChIKey | JHWOWIMCORWISE-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|