C31H39FN2O6Si — CID 54560816
2-trimethylsilylethyl 3-[[4-(2-carbamoyloxyethoxy)naphthalen-2-yl]methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 54560816) has the molecular formula C31H39FN2O6Si and a molecular weight of 582.75 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-[[4-(2-carbamoyloxyethoxy)naphthalen-2-yl]methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 3-[[4-(2-carbamoyloxyethoxy)naphthalen-2-yl]methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54560816 |
| Molecular Formula | C31H39FN2O6Si |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 2-trimethylsilylethyl 3-[[4-(2-carbamoyloxyethoxy)naphthalen-2-yl]methoxy]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCC(c2ccc(F)cc2)C(OCc2cc(OCCOC(N)=O)c3ccccc3c2)C1 |
| InChI | InChI=1S/C31H39FN2O6Si/c1-41(2,3)17-16-39-31(36)34-13-12-27(23-8-10-25(32)11-9-23)29(20-34)40-21-22-18-24-6-4-5-7-26(24)28(19-22)37-14-15-38-30(33)35/h4-11,18-19,27,29H,12-17,20-21H2,1-3H3,(H2,33,35) |
| InChIKey | ZQKJVBVFKRVQFY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|