C32H33NO6 — CID 22127119
3-[(4-hydroxynaphthalen-2-yl)methoxy]-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 22127119) has the molecular formula C32H33NO6 and a molecular weight of 527.62 g/mol. Its IUPAC name is 3-[(4-hydroxynaphthalen-2-yl)methoxy]-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(4-hydroxynaphthalen-2-yl)methoxy]-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22127119 |
| Molecular Formula | C32H33NO6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 3-[(4-hydroxynaphthalen-2-yl)methoxy]-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(OCCOCc3ccccc3)cc2)C(OCc2cc(O)c3ccccc3c2)C1 |
| InChI | InChI=1S/C32H33NO6/c34-30-19-24(18-26-8-4-5-9-28(26)30)22-39-31-20-33(32(35)36)15-14-29(31)25-10-12-27(13-11-25)38-17-16-37-21-23-6-2-1-3-7-23/h1-13,18-19,29,31,34H,14-17,20-22H2,(H,35,36) |
| InChIKey | VELNHVMQQHCIGS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|