C32H33NO5 — CID 22126829
3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine-1-carboxylic acid (PubChem CID 22126829) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22126829 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(2-phenoxyethoxymethyl)phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(COCCOc3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C32H33NO5/c34-32(35)33-17-16-30(31(21-33)38-23-25-12-13-26-6-4-5-7-28(26)20-25)27-14-10-24(11-15-27)22-36-18-19-37-29-8-2-1-3-9-29/h1-15,20,30-31H,16-19,21-23H2,(H,34,35) |
| InChIKey | CSIJYMPFJCSFFI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|