C30H34ClNO6 — CID 22126695
3-[(3-chloro-4-methoxyphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 22126695) has the molecular formula C30H34ClNO6 and a molecular weight of 540.06 g/mol. Its IUPAC name is 3-[(3-chloro-4-methoxyphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(3-chloro-4-methoxyphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22126695 |
| Molecular Formula | C30H34ClNO6 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 3-[(3-chloro-4-methoxyphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | COc1ccc(COC2CN(C(=O)O)CCC2c2ccc(OCCCOCc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C30H34ClNO6/c1-35-28-13-8-23(18-27(28)31)21-38-29-19-32(30(33)34)15-14-26(29)24-9-11-25(12-10-24)37-17-5-16-36-20-22-6-3-2-4-7-22/h2-4,6-13,18,26,29H,5,14-17,19-21H2,1H3,(H,33,34) |
| InChIKey | LNBJCWOYTFMFRW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|