C34H42BrNO5 — CID 54514912
tert-butyl 3-[[4-(bromomethyl)phenyl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate (PubChem CID 54514912) has the molecular formula C34H42BrNO5 and a molecular weight of 624.62 g/mol. Its IUPAC name is tert-butyl 3-[[4-(bromomethyl)phenyl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(bromomethyl)phenyl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54514912 |
| Molecular Formula | C34H42BrNO5 |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | tert-butyl 3-[[4-(bromomethyl)phenyl]methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc(CBr)cc2)C1 |
| InChI | InChI=1S/C34H42BrNO5/c1-34(2,3)41-33(37)36-19-18-31(32(23-36)40-25-28-12-10-26(22-35)11-13-28)29-14-16-30(17-15-29)39-21-7-20-38-24-27-8-5-4-6-9-27/h4-6,8-17,31-32H,7,18-25H2,1-3H3 |
| InChIKey | YLTAHHRBVNPWQC-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|