C40H45Cl2NO6 — CID 76635115
tert-butyl 3,5-bis[(4-chlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate (PubChem CID 76635115) has the molecular formula C40H45Cl2NO6 and a molecular weight of 706.71 g/mol. Its IUPAC name is tert-butyl 3,5-bis[(4-chlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,5-bis[(4-chlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 76635115 |
| Molecular Formula | C40H45Cl2NO6 |
| Molecular Weight | 706.71 g/mol |
| Exact Mass | 705.26 |
| IUPAC Name | tert-butyl 3,5-bis[(4-chlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccc(Cl)cc2)C(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C40H45Cl2NO6/c1-40(2,3)49-39(44)43-24-36(47-27-30-10-16-33(41)17-11-30)38(37(25-43)48-28-31-12-18-34(42)19-13-31)32-14-20-35(21-15-32)46-23-7-22-45-26-29-8-5-4-6-9-29/h4-6,8-21,36-38H,7,22-28H2,1-3H3 |
| InChIKey | QVBGHGVHQJWHDB-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.71 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|