C27H37NO7 — CID 54253597
tert-butyl 3,5-dihydroxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 54253597) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is tert-butyl 3,5-dihydroxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,5-dihydroxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54253597 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | tert-butyl 3,5-dihydroxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | COc1ccccc1COCCCOc1ccc(C2C(O)CN(C(=O)OC(C)(C)C)CC2O)cc1 |
| InChI | InChI=1S/C27H37NO7/c1-27(2,3)35-26(31)28-16-22(29)25(23(30)17-28)19-10-12-21(13-11-19)34-15-7-14-33-18-20-8-5-6-9-24(20)32-4/h5-6,8-13,22-23,25,29-30H,7,14-18H2,1-4H3 |
| InChIKey | QYLXYUCCZNXXAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|