C39H47N3O7 — CID 57120380
tert-butyl (3R,5S)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3,5-bis(pyridin-4-ylmethoxy)piperidine-1-carboxylate (PubChem CID 57120380) has the molecular formula C39H47N3O7 and a molecular weight of 669.82 g/mol. Its IUPAC name is tert-butyl (3R,5S)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3,5-bis(pyridin-4-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3,5-bis(pyridin-4-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57120380 |
| Molecular Formula | C39H47N3O7 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.34 |
| IUPAC Name | tert-butyl (3R,5S)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3,5-bis(pyridin-4-ylmethoxy)piperidine-1-carboxylate |
| SMILES | COc1ccccc1COCCCOc1ccc(C2[C@@H](OCc3ccncc3)CN(C(=O)OC(C)(C)C)C[C@H]2OCc2ccncc2)cc1 |
| InChI | InChI=1S/C39H47N3O7/c1-39(2,3)49-38(43)42-24-35(47-26-29-14-18-40-19-15-29)37(36(25-42)48-27-30-16-20-41-21-17-30)31-10-12-33(13-11-31)46-23-7-22-45-28-32-8-5-6-9-34(32)44-4/h5-6,8-21,35-37H,7,22-28H2,1-4H3/t35-,36+,37? |
| InChIKey | JKVZQPXALDRJPW-VUIRNMKQSA-N |
| XLogP | 6.98 |
| TPSA | 101.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|